EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22O4 |
| Net Charge | 0 |
| Average Mass | 254.326 |
| Monoisotopic Mass | 254.15181 |
| SMILES | C=C1C(=O)OC(CCCCCCCC)C1C(=O)O |
| InChI | InChI=1S/C14H22O4/c1-3-4-5-6-7-8-9-11-12(13(15)16)10(2)14(17)18-11/h11-12H,2-9H2,1H3,(H,15,16) |
| InChIKey | VCWLZDVWHQVAJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylidene-2-octyl-5-oxotetrahydrofuran-3-carboxylic acid (CHEBI:191402) is a monocarboxylic acid (CHEBI:25384) |
| 4-methylidene-2-octyl-5-oxotetrahydrofuran-3-carboxylic acid (CHEBI:191402) is a tetrahydrofuranone (CHEBI:47016) |
| Incoming Relation(s) |
| (2R,3S)-C75 (CHEBI:191400) is a 4-methylidene-2-octyl-5-oxotetrahydrofuran-3-carboxylic acid (CHEBI:191402) |
| (2S,3R)-C75 (CHEBI:191401) is a 4-methylidene-2-octyl-5-oxotetrahydrofuran-3-carboxylic acid (CHEBI:191402) |
| IUPAC Name |
|---|
| 4-methylidene-2-octyl-5-oxotetrahydrofuran-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-methylidene-2-octyl-5-oxooxolane-3-carboxylic acid | IUPAC |
| tetrahydro-4-methylene-2-octyl-5-oxo-3-furancarboxylic acid | ChEBI |
| 4-methylene-2-octyl-5-oxotetrahydrofuran-3-carboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3456585 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:218137-86-1 | ChemIDplus |