EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20BrN3O2S |
| Net Charge | 0 |
| Average Mass | 446.370 |
| Monoisotopic Mass | 445.04596 |
| SMILES | O=S(=O)(NCCNC/C=C/c1ccc(Br)cc1)c1cccc2cnccc12 |
| InChI | InChI=1S/C20H20BrN3O2S/c21-18-8-6-16(7-9-18)3-2-11-22-13-14-24-27(25,26)20-5-1-4-17-15-23-12-10-19(17)20/h1-10,12,15,22,24H,11,13-14H2/b3-2+ |
| InChIKey | ZKZXNDJNWUTGDK-NSCUHMNNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.11 (cAMP-dependent protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cAMP-dependent protein kinase (EC 2.7.11.11). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-N-[2-(4-bromocinnamylamino)ethyl]isoquinoline-5-sulfonamide (CHEBI:191396) is a N-[2-(4-bromocinnamylamino)ethyl]isoquinoline-5-sulfonamide (CHEBI:47495) |
| IUPAC Name |
|---|
| N-(2-{[(2E)-3-(4-bromophenyl)prop-2-en-1-yl]amino}ethyl)isoquinoline-5-sulfonamide |
| Synonyms | Source |
|---|---|
| H-89 (E-isomer) | ChEBI |
| N-[2-[[(E)-3-(4-bromophenyl)prop-2-enyl]amino]ethyl]isoquinoline-5-sulfonamide | PDBeChem |