EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50N6O7 |
| Net Charge | 0 |
| Average Mass | 606.765 |
| Monoisotopic Mass | 606.37410 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H]2CC[C@H]3O[C@H](C)[C@@H](NC1=O)C(=O)N32 |
| InChI | InChI=1S/C30H50N6O7/c1-14(2)11-19-26(38)31-17(7)25(37)32-21(13-16(5)6)28(40)35-24-18(8)43-23-10-9-22(36(23)30(24)42)29(41)34-20(12-15(3)4)27(39)33-19/h14-24H,9-13H2,1-8H3,(H,31,38)(H,32,37)(H,33,39)(H,34,41)(H,35,40)/t17-,18-,19+,20-,21+,22+,23-,24-/m1/s1 |
| InChIKey | KALBWDFILFPIEW-MGESPVMDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fusahexin (CHEBI:191392) has role fungal metabolite (CHEBI:76946) |
| fusahexin (CHEBI:191392) is a cyclic peptide (CHEBI:23449) |
| UniProt Name | Source |
|---|---|
| fusahexin | UniProt |
| Citations |
|---|