EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16F4N2O2 |
| Net Charge | 0 |
| Average Mass | 380.341 |
| Monoisotopic Mass | 380.11479 |
| SMILES | CN1C[C@H](c2cccc(C(F)(F)F)c2)[C@@H](C(=O)Nc2ccccc2F)C1=O |
| InChI | InChI=1S/C19H16F4N2O2/c1-25-10-13(11-5-4-6-12(9-11)19(21,22)23)16(18(25)27)17(26)24-15-8-3-2-7-14(15)20/h2-9,13,16H,10H2,1H3,(H,24,26)/t13-,16+/m1/s1 |
| InChIKey | QQDYOLJZDUADHV-CJNGLKHVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.3.5.2 [dihydroorotate dehydrogenase (quinone)] inhibitor An EC 1.3.5.* (oxidoreductase acting on CH-CH of donor with a quinone or related compound as acceptor) inhibitor that interferes with the action of dihydroorotate dehydrogenase (quinone), EC 1.3.5.2. pyrimidine synthesis inhibitor A pathway inhibitor that inhibits the synthesis of pyrimidine. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetflupyrolimet (CHEBI:191391) has role EC 1.3.5.2 [dihydroorotate dehydrogenase (quinone)] inhibitor (CHEBI:77103) |
| tetflupyrolimet (CHEBI:191391) has role herbicide (CHEBI:24527) |
| tetflupyrolimet (CHEBI:191391) has role pyrimidine synthesis inhibitor (CHEBI:68543) |
| tetflupyrolimet (CHEBI:191391) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| tetflupyrolimet (CHEBI:191391) is a N-alkylpyrrolidine (CHEBI:46775) |
| tetflupyrolimet (CHEBI:191391) is a anilide (CHEBI:13248) |
| tetflupyrolimet (CHEBI:191391) is a monofluorobenzenes (CHEBI:83575) |
| tetflupyrolimet (CHEBI:191391) is a pyrrolidinecarboxamide (CHEBI:46770) |
| tetflupyrolimet (CHEBI:191391) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (3S,4S)-N-(2-fluorophenyl)-1-methyl-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| Synonyms | Source |
|---|---|
| (3S,4S)-2'-fluoro-1-methyl-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxanilide | Alan Wood's Pesticides |
| (3S,4S)-2'-fluoro-1-methyl-2-oxo-4-(α,α,α-trifluoro-m-tolyl)pyrrolidine-3-carboxanilide | Alan Wood's Pesticides |
| (3S,4S)-N-(2-fluorophenyl)-1-methyl-2-oxo-4-[3-(trifluoromethyl)phenyl]-3-pyrrolidinecarboxamide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 3293 | PPDB |
| 71078725 | ChemSpider |
| tetflupyrolimet | Alan Wood's Pesticides |
| WO2016196593 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:2053901-33-8 | ChemIDplus |
| Citations |
|---|