EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O |
| Net Charge | 0 |
| Average Mass | 122.167 |
| Monoisotopic Mass | 122.07316 |
| SMILES | Cc1ccc(C)c(O)c1 |
| InChI | InChI=1S/C8H10O/c1-6-3-4-7(2)8(9)5-6/h3-5,9H,1-2H3 |
| InChIKey | NKTOLZVEWDHZMU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlaenius cordicollis (ncbitaxon:41305) | - | PubMed (22392083) | |
| Pinus sibirica (ncbitaxon:62752) | - | PubMed (25641836) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-xylenol (CHEBI:191381) has parent hydride p-xylene (CHEBI:27417) |
| 2,5-xylenol (CHEBI:191381) has role animal metabolite (CHEBI:75767) |
| 2,5-xylenol (CHEBI:191381) has role volatile oil component (CHEBI:27311) |
| 2,5-xylenol (CHEBI:191381) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 2,5-dimethylphenyl hydrogen sulfate (CHEBI:191382) has functional parent 2,5-xylenol (CHEBI:191381) |
| IUPAC Name |
|---|
| 2,5-dimethylphenol |
| Synonyms | Source |
|---|---|
| 1,2,5-xylenol | ChemIDplus |
| 1,4-dimethyl-2-hydroxybenzene | ChemIDplus |
| 1-hydroxy-2,5-dimethylbenzene | ChemIDplus |
| 2,5-Dmp | ChemIDplus |
| 2,5-xylenol | ChemIDplus |
| 2-hydroxy-p-xylene | ChEBI |
| Citations |
|---|