EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O8 |
| Net Charge | 0 |
| Average Mass | 304.255 |
| Monoisotopic Mass | 304.09067 |
| SMILES | CC(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16N2O8/c1-5(14)12-7(4-9(17)18)10(19)13-6(11(20)21)2-3-8(15)16/h6-7H,2-4H2,1H3,(H,12,14)(H,13,19)(H,15,16)(H,17,18)(H,20,21)/t6-,7+/m0/s1 |
| InChIKey | OPVPGKGADVGKTG-NKWVEPMBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | hTERT-RPE1 cell (BTO:0004790) | MetaboLights (MTBLS682) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Acetyl-aspartyl-glutamate (CHEBI:191259) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R)-2-acetamido-3-carboxypropanoyl]amino]pentanedioic acid |