EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21NO2 |
| Net Charge | 0 |
| Average Mass | 223.316 |
| Monoisotopic Mass | 223.15723 |
| SMILES | CCc1cc(OC)c(CC(C)N)cc1OC |
| InChI | InChI=1S/C13H21NO2/c1-5-10-7-13(16-4)11(6-9(2)14)8-12(10)15-3/h7-9H,5-6,14H2,1-4H3 |
| InChIKey | HXJKWPGVENNMCC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | hTERT-RPE1 cell (BTO:0004790) | MetaboLights (MTBLS682) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-Dimethoxy-4-ethylamphetamine (CHEBI:191249) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| 1-(4-ethyl-2,5-dimethoxyphenyl)propan-2-amine |
| Registry Numbers | Sources |
|---|---|
| CAS:22004-32-6 | ChemIDplus |