EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O5 |
| Net Charge | -2 |
| Average Mass | 328.364 |
| Monoisotopic Mass | 328.13217 |
| SMILES | [H][C@]12CC[C@@]3([H])C4=CC(=O)C[C@@](C)(C(=O)[O-])[C@@]4([H])[C@H](C(=O)[O-])[C@@]3(CC1=C)C2 |
| InChI | InChI=1S/C19H22O5/c1-9-6-19-7-10(9)3-4-13(19)12-5-11(20)8-18(2,17(23)24)14(12)15(19)16(21)22/h5,10,13-15H,1,3-4,6-8H2,2H3,(H,21,22)(H,23,24)/p-2/t10-,13+,14-,15-,18-,19+/m1/s1 |
| InChIKey | JBJGOHHQQSPYTO-BLMVKCSQSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | hTERT-RPE1 cell (BTO:0004790) | MetaboLights (MTBLS682) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GA51-catabolite (CHEBI:191246) is a C19-gibberellin (CHEBI:20858) |
| GA51-catabolite (CHEBI:191246) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,9R,12R)-4-methyl-13-methylidene-6-oxotetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2,4-dicarboxylate |