EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H14NO.C5H3N2O4 |
| Net Charge | 0 |
| Average Mass | 259.262 |
| Monoisotopic Mass | 259.11682 |
| SMILES | C[N+](C)(C)CCO.O=C([O-])c1cc(=O)nc(=O)n1 |
| InChI | InChI=1S/C5H4N2O4.C5H14NO/c8-3-1-2(4(9)10)6-5(11)7-3;1-6(2,3)4-5-7/h1H,(H,9,10)(H2,6,7,8,11);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | IMAGLCGCHKGGLR-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | hTERT-RPE1 cell (BTO:0004790) | MetaboLights (MTBLS682) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Choline orotate (CHEBI:191245) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| 2,4-dioxo-1H-pyrimidine-6-carboxylate;2-hydroxyethyl(trimethyl)azanium |
| Registry Numbers | Sources |
|---|---|
| CAS:24381-49-5 | ChemIDplus |