EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H39NO3 |
| Net Charge | 0 |
| Average Mass | 317.514 |
| Monoisotopic Mass | 317.29299 |
| SMILES | CCCCCCCCCCCCCCC(O)[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3/t16-,17?,18-/m0/s1 |
| InChIKey | AERBNCYCJBRYDG-RGBJRUIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | hTERT-RPE1 cell (BTO:0004790) | MetaboLights (MTBLS682) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxysphinganine (CHEBI:191244) is a amino alcohol (CHEBI:22478) |
| IUPAC Name |
|---|
| (2S,3S)-2-aminooctadecane-1,3,4-triol |
| Manual Xrefs | Databases |
|---|---|
| 57452182 | ChemSpider |
| C12144 | KEGG COMPOUND |
| LMSP01030001 | LIPID MAPS |