EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NO |
| Net Charge | 0 |
| Average Mass | 283.415 |
| Monoisotopic Mass | 283.19361 |
| SMILES | CCCN(CCC)C1Cc2cccc3cc(O)cc(c23)C1 |
| InChI | InChI=1S/C19H25NO/c1-3-8-20(9-4-2)17-10-14-6-5-7-15-12-18(21)13-16(11-17)19(14)15/h5-7,12-13,17,21H,3-4,8-11H2,1-2H3 |
| InChIKey | TWUJBHBRYYTEDL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | hTERT-RPE1 cell (BTO:0004790) | MetaboLights (MTBLS682) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alentemol (CHEBI:191243) is a ortho- and peri-fused tricyclic hydrocarbon (CHEBI:51120) |
| IUPAC Name |
|---|
| 5-(dipropylamino)-5,6-dihydro-4H-phenalen-2-ol |
| Manual Xrefs | Databases |
|---|---|
| 54603 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:112891-97-1 | ChemIDplus |