EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O2 |
| Net Charge | 0 |
| Average Mass | 274.404 |
| Monoisotopic Mass | 274.19328 |
| SMILES | CCCC/C=C/C#CC#CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-6H,2-4,11-17H2,1H3,(H,19,20)/b6-5+ |
| InChIKey | ACHMRCSARDWYGC-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | hTERT-RPE1 cell (BTO:0004790) | MetaboLights (MTBLS682) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13E-octadecene-9,11-diynoic acid (CHEBI:191240) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E)-octadec-13-en-9,11-diynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472109 | ChemSpider |
| LMFA01030556 | LIPID MAPS |