EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H30O2 |
| Net Charge | 0 |
| Average Mass | 266.425 |
| Monoisotopic Mass | 266.22458 |
| SMILES | CCCCC#CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C17H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-4,7-16H2,1H3,(H,18,19) |
| InChIKey | IBUAUJXYADRLIN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | hTERT-RPE1 cell (BTO:0004790) | MetaboLights (MTBLS682) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-heptadecynoic acid (CHEBI:191237) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| heptadec-12-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472050 | ChemSpider |
| LMFA01030486 | LIPID MAPS |