EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O3 |
| Net Charge | 0 |
| Average Mass | 214.220 |
| Monoisotopic Mass | 214.06299 |
| SMILES | O=C1c2ccccc2C2=CC=CC(O)C12O |
| InChI | InChI=1S/C13H10O3/c14-11-7-3-6-10-8-4-1-2-5-9(8)12(15)13(10,11)16/h1-7,11,14,16H |
| InChIKey | CZWUUOGKBHOBEC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | hTERT-RPE1 cell (BTO:0004790) | MetaboLights (MTBLS682) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,10-dihydro-1,10-dihydroxyfluoren-9-one (CHEBI:191235) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| 1,9a-dihydroxy-1H-luoren-9-one |
| Manual Xrefs | Databases |
|---|---|
| 28565373 | ChemSpider |