EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21NO2 |
| Net Charge | 0 |
| Average Mass | 187.283 |
| Monoisotopic Mass | 187.15723 |
| SMILES | NCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H21NO2/c11-9-7-5-3-1-2-4-6-8-10(12)13/h1-9,11H2,(H,12,13) |
| InChIKey | XAUQWYHSQICPAZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | hTERT-RPE1 cell (BTO:0004790) | MetaboLights (MTBLS682) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-amino-decanoic acid (CHEBI:191232) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 10-aminodecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 75018 | ChemSpider |
| C72238 | KEGG COMPOUND |
| LMFA01100002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:13108-19-5 | ChemIDplus |