EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O2 |
| Net Charge | 0 |
| Average Mass | 156.225 |
| Monoisotopic Mass | 156.11503 |
| SMILES | C=CC(CCCCC)C(=O)O |
| InChI | InChI=1S/C9H16O2/c1-3-5-6-7-8(4-2)9(10)11/h4,8H,2-3,5-7H2,1H3,(H,10,11) |
| InChIKey | VJICCZIMJKBXME-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | hTERT-RPE1 cell (BTO:0004790) | MetaboLights (MTBLS682) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amyl 3-butenoic acid (CHEBI:191228) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 2-ethenylheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4445793 | ChemSpider |
| LMFA01020127 | LIPID MAPS |