EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22Cl2O5 |
| Net Charge | 0 |
| Average Mass | 413.297 |
| Monoisotopic Mass | 412.08443 |
| SMILES | CCCCOC(=O)OC1=C(c2ccc(Cl)cc2Cl)C(=O)OC12CCCCC2 |
| InChI | InChI=1S/C20H22Cl2O5/c1-2-3-11-25-19(24)26-17-16(14-8-7-13(21)12-15(14)22)18(23)27-20(17)9-5-4-6-10-20/h7-8,12H,2-6,9-11H2,1H3 |
| InChIKey | HEOYPZMAGQITRO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spirobudifen (CHEBI:191221) is a carbonate ester (CHEBI:46722) |
| spirobudifen (CHEBI:191221) is a dichlorobenzene (CHEBI:23697) |
| spirobudifen (CHEBI:191221) is a organochlorine acaricide (CHEBI:38657) |
| spirobudifen (CHEBI:191221) is a oxaspiro compound (CHEBI:37948) |
| IUPAC Name |
|---|
| butyl 3-(2,4-dichlorophenyl)-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl carbonate |
| Manual Xrefs | Databases |
|---|---|
| spirobudifen | Alan Wood's Pesticides |
| 109120575 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:1305319-70-3 | Alan Wood's Pesticides |