EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H12ClF4N3O6 |
| Net Charge | 0 |
| Average Mass | 489.765 |
| Monoisotopic Mass | 489.03508 |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2cc(Oc3cccnc3OCC(=O)O)c(Cl)cc2F)c1=O |
| InChI | InChI=1S/C19H12ClF4N3O6/c1-26-14(19(22,23)24)7-15(28)27(18(26)31)11-6-13(9(20)5-10(11)21)33-12-3-2-4-25-17(12)32-8-16(29)30/h2-7H,8H2,1H3,(H,29,30) |
| InChIKey | XZWQUPYFQIJUQZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-3100-CA (CHEBI:191219) has role drug metabolite (CHEBI:49103) |
| S-3100-CA (CHEBI:191219) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| S-3100-CA (CHEBI:191219) has role hepatotoxic agent (CHEBI:50908) |
| S-3100-CA (CHEBI:191219) has role herbicide (CHEBI:24527) |
| S-3100-CA (CHEBI:191219) has role rat metabolite (CHEBI:86264) |
| S-3100-CA (CHEBI:191219) is a aromatic ether (CHEBI:35618) |
| S-3100-CA (CHEBI:191219) is a diether (CHEBI:46786) |
| S-3100-CA (CHEBI:191219) is a monocarboxylic acid (CHEBI:25384) |
| S-3100-CA (CHEBI:191219) is a monochlorobenzenes (CHEBI:83403) |
| S-3100-CA (CHEBI:191219) is a monofluorobenzenes (CHEBI:83575) |
| S-3100-CA (CHEBI:191219) is a organofluorine compound (CHEBI:37143) |
| S-3100-CA (CHEBI:191219) is a pyridines (CHEBI:26421) |
| S-3100-CA (CHEBI:191219) is a pyrimidone (CHEBI:38337) |
| Incoming Relation(s) |
| epyrifenacil (CHEBI:191218) has functional parent S-3100-CA (CHEBI:191219) |
| IUPAC Name |
|---|
| [(3-{2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3,6-dihydropyrimidin-1(2H)-yl]phenoxy}pyridin-2-yl)oxy]acetic acid |
| Citations |
|---|