EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25N2O3 |
| Net Charge | +1 |
| Average Mass | 329.420 |
| Monoisotopic Mass | 329.18597 |
| SMILES | C[C@H](CCc1ccccc1)[NH2+]C[C@H](O)c1ccc(O)c(C(N)=O)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-13(7-8-14-5-3-2-4-6-14)21-12-18(23)15-9-10-17(22)16(11-15)19(20)24/h2-6,9-11,13,18,21-23H,7-8,12H2,1H3,(H2,20,24)/p+1/t13-,18+/m1/s1 |
| InChIKey | SGUAFYQXFOLMHL-ACJLOTCBSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dilevalol(1+) (CHEBI:191214) is a secondary ammonium ion (CHEBI:137419) |
| dilevalol(1+) (CHEBI:191214) is conjugate acid of (R,R)-labetalol (CHEBI:94471) |
| Incoming Relation(s) |
| dilevalol hydrochloride (CHEBI:31494) has part dilevalol(1+) (CHEBI:191214) |
| (R,R)-labetalol (CHEBI:94471) is conjugate base of dilevalol(1+) (CHEBI:191214) |
| IUPAC Name |
|---|
| (2R)-N-[(2R)-2-(3-carbamoyl-4-hydroxyphenyl)-2-hydroxyethyl]-4-phenylbutan-2-aminium |
| Synonyms | Source |
|---|---|
| dilevalol cation | ChEBI |
| (R,R)-labetalol(1+) | ChEBI |
| (R,R)-labetalol cation | ChEBI |