EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24N2O3 |
| Net Charge | 0 |
| Average Mass | 244.335 |
| Monoisotopic Mass | 244.17869 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]([NH3+])CC(C)C)C(=O)[O-] |
| InChI | InChI=1S/C12H24N2O3/c1-7(2)5-9(13)11(15)14-10(12(16)17)6-8(3)4/h7-10H,5-6,13H2,1-4H3,(H,14,15)(H,16,17)/t9-,10-/m0/s1 |
| InChIKey | LCPYQJIKPJDLLB-UWVGGRQHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Leu zwitterion (CHEBI:191208) is a L-aminoacyl-L-amino acid zwitterion (CHEBI:77460) |
| Leu-Leu zwitterion (CHEBI:191208) is tautomer of Leu-Leu (CHEBI:73531) |
| Incoming Relation(s) |
| Leu-Leu (CHEBI:73531) is tautomer of Leu-Leu zwitterion (CHEBI:191208) |
| IUPAC Name |
|---|
| (2S)-2-{[(2S)-2-azaniumyl-4-methylpentanoyl]amino}-4-methylpentanoate |
| Synonyms | Source |
|---|---|
| LL dipeptide zwitterion | ChEBI |
| LL zwitterion | ChEBI |
| L-leucyl-L-leucine zwitterion | ChEBI |
| L-Leu-L-Leu zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-leucyl-L-leucine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| L-LEUCYL-L-LEUCINE | MetaCyc |
| Citations |
|---|