EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15F3N2O3 |
| Net Charge | 0 |
| Average Mass | 340.301 |
| Monoisotopic Mass | 340.10348 |
| SMILES | FC(F)(F)c1ccc(COc2ncncc2C2OCCCO2)cc1 |
| InChI | InChI=1S/C16H15F3N2O3/c17-16(18,19)12-4-2-11(3-5-12)9-24-14-13(8-20-10-21-14)15-22-6-1-7-23-15/h2-5,8,10,15H,1,6-7,9H2 |
| InChIKey | ZYXYTGQFPZEUFX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | insect growth regulator A growth regulator that inhibits the life cycle of an insect. |
| Applications: | insect growth regulator A growth regulator that inhibits the life cycle of an insect. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzpyrimoxan (CHEBI:191194) has role agrochemical (CHEBI:33286) |
| benzpyrimoxan (CHEBI:191194) has role insect growth regulator (CHEBI:24851) |
| benzpyrimoxan (CHEBI:191194) has role insecticide (CHEBI:24852) |
| benzpyrimoxan (CHEBI:191194) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| benzpyrimoxan (CHEBI:191194) is a aromatic ether (CHEBI:35618) |
| benzpyrimoxan (CHEBI:191194) is a dioxanes (CHEBI:46926) |
| benzpyrimoxan (CHEBI:191194) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| 5-(1,3-dioxan-2-yl)-4-{[4-(trifluoromethyl)benzyl]oxy}pyrimidine |
| Synonyms | Source |
|---|---|
| 5-(1,3-dioxan-2-yl)-4-{[4-(trifluoromethyl)phenyl]methoxy}pyrimidine | IUPAC |
| 5-(1,3-dioxan-2-yl)pyrimidin-4-yl 4-(trifluoromethyl)benzyl ether | Alan Wood's Pesticides |
| 5-(1,3-dioxan-2-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrimidine | Alan Wood's Pesticides |
| NNI-1501 | PPDB |
| Brand Names | Source |
|---|---|
| Orchestra | ChEBI |
| Orchestra Flowable | ChEBI |
| Orchestra Dust | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3262 | PPDB |
| benzpyrimoxan | Alan Wood's Pesticides |
| 58828733 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27718023 | Reaxys |
| CAS:1449021-97-9 | ChemIDplus |
| Citations |
|---|