EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO2 |
| Net Charge | 0 |
| Average Mass | 143.186 |
| Monoisotopic Mass | 143.09463 |
| SMILES | CN1CCCCC1C(=O)O |
| InChI | InChI=1S/C7H13NO2/c1-8-5-3-2-4-6(8)7(9)10/h6H,2-5H2,1H3,(H,9,10) |
| InChIKey | BPSLZWSRHTULGU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Triticum aestivum (ncbitaxon:4565) | leaf (BTO:0000713) | MetaboLights (MTBLS4542) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methylpipecolic acid (CHEBI:191185) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 1-methylpiperidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 368258 | ChemSpider |