EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O7 |
| Net Charge | 0 |
| Average Mass | 418.486 |
| Monoisotopic Mass | 418.19915 |
| SMILES | C[C@H]1CCCC(=O)CCC/C=C/c2cc(OCCCCC(=O)O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C23H30O7/c1-16-8-7-11-18(24)10-4-2-3-9-17-14-19(29-13-6-5-12-21(26)27)15-20(25)22(17)23(28)30-16/h3,9,14-16,25H,2,4-8,10-13H2,1H3,(H,26,27)/b9-3+/t16-/m0/s1 |
| InChIKey | KAKLPRJCHJCTSM-CFZDNBDDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zearalenone hapten ZEp (CHEBI:191183) has functional parent zearalenone (CHEBI:10106) |
| zearalenone hapten ZEp (CHEBI:191183) has role hapten (CHEBI:59174) |
| zearalenone hapten ZEp (CHEBI:191183) is a macrolide (CHEBI:25106) |
| zearalenone hapten ZEp (CHEBI:191183) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 5-{[(3S,11E)-16-hydroxy-3-methyl-1,7-dioxo-3,4,5,6,7,8,9,10-octahydro-1H-2-benzoxacyclotetradecin-14-yl]oxy}pentanoic acid |
| Synonyms | Source |
|---|---|
| hapten ZEp | ChEBI |
| (S,E)-5-((16-hydroxy-3-methyl-1,7-dioxo-3,4,5,6,7,8,9,10-octahydro-1H-benzo[c][1]oxacyclotetradecin-14-yl)oxy)pentanoic acid | ChEBI |
| Citations |
|---|