EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35NO7 |
| Net Charge | 0 |
| Average Mass | 449.544 |
| Monoisotopic Mass | 449.24135 |
| SMILES | C[C@H]1CCCC(NOCCCCCC(=O)O)CCC/C=C/c2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C24H35NO7/c1-17-9-8-12-19(25-31-14-7-3-6-13-22(28)29)11-5-2-4-10-18-15-20(26)16-21(27)23(18)24(30)32-17/h4,10,15-17,19,25-27H,2-3,5-9,11-14H2,1H3,(H,28,29)/b10-4+/t17-,19?/m0/s1 |
| InChIKey | RUWZGLIXFBNPKR-URELGRSRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zearalenone hapten ZEo (CHEBI:191182) has functional parent zearalenone (CHEBI:10106) |
| zearalenone hapten ZEo (CHEBI:191182) has role hapten (CHEBI:59174) |
| zearalenone hapten ZEo (CHEBI:191182) is a macrolide (CHEBI:25106) |
| zearalenone hapten ZEo (CHEBI:191182) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 6-({[(3S,11E)-14,16-dihydroxy-3-methyl-1-oxo-1,3,4,5,6,8,9,10-octahydro-7H-2-benzoxacyclotetradecin-7-ylidene]amino}oxy)hexanoic acid |
| Synonyms | Source |
|---|---|
| 6-((((SS,E)-14,16-dihydroxy-3-methyl-1-oxo-1,3,4,5,6,8,9,10-octahydro-7H-benz[c][1]oxacyclotetradecin-7-ylidene)amino)oxy)hexanoic acid | ChEBI |
| hapten ZEo | ChEBI |
| Citations |
|---|