EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H23N3O2S |
| Net Charge | 0 |
| Average Mass | 261.391 |
| Monoisotopic Mass | 261.15110 |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)CC(C)C)C(N)=O |
| InChI | InChI=1S/C11H23N3O2S/c1-7(2)6-8(12)11(16)14-9(10(13)15)4-5-17-3/h7-9H,4-6,12H2,1-3H3,(H2,13,15)(H,14,16)/t8-,9-/m0/s1 |
| InChIKey | FMHTVEOMIPKKJG-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Leu-L-Met-NH2 (CHEBI:191171) has functional parent L-leucine (CHEBI:15603) |
| L-Leu-L-Met-NH2 (CHEBI:191171) has functional parent L-methioninamide (CHEBI:21362) |
| L-Leu-L-Met-NH2 (CHEBI:191171) is a dipeptide (CHEBI:46761) |
| L-Leu-L-Met-NH2 (CHEBI:191171) is conjugate base of L-Leu-L-Met-NH2(1+) (CHEBI:190700) |
| Incoming Relation(s) |
| L-Leu-L-Met-NH2(1+) (CHEBI:190700) is conjugate acid of L-Leu-L-Met-NH2 (CHEBI:191171) |
| IUPAC Name |
|---|
| L-leucyl-L-methioninamide |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-N-[(2S)-1-amino-4-(methylsulfanyl)-1-oxobutan-2-yl]-4-methylpentanamide | IUPAC |
| H-Leu-Met-NH2 | ChEBI |
| Leu-Met-NH2 | ChEBI |
| LM-NH2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5384715 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:16217-56-4 | ChEBI |
| Citations |
|---|