EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O4 |
| Net Charge | 0 |
| Average Mass | 228.248 |
| Monoisotopic Mass | 228.11101 |
| SMILES | CC(C)C(NC(=O)C1CCC(=O)N1)C(=O)O |
| InChI | InChI=1S/C10H16N2O4/c1-5(2)8(10(15)16)12-9(14)6-3-4-7(13)11-6/h5-6,8H,3-4H2,1-2H3,(H,11,13)(H,12,14)(H,15,16) |
| InChIKey | DTSWLLBBGHRXQH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyroglu-val (CHEBI:191162) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 3-methyl-2-[(5-oxopyrrolidine-2-carbonyl)amino]butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 15445378 | ChemSpider |