EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O5 |
| Net Charge | 0 |
| Average Mass | 292.291 |
| Monoisotopic Mass | 292.10592 |
| SMILES | O=C1CCC(C(=O)NC(Cc2ccc(O)cc2)C(=O)O)N1 |
| InChI | InChI=1S/C14H16N2O5/c17-9-3-1-8(2-4-9)7-11(14(20)21)16-13(19)10-5-6-12(18)15-10/h1-4,10-11,17H,5-7H2,(H,15,18)(H,16,19)(H,20,21) |
| InChIKey | ILJOYLTXYCZXTB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyroglu-tyr (CHEBI:191161) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 3-(4-hydroxyphenyl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10466085 | ChemSpider |