EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO |
| Net Charge | 0 |
| Average Mass | 223.275 |
| Monoisotopic Mass | 223.09971 |
| SMILES | CC(=O)Nc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C15H13NO/c1-10(17)16-15-8-4-7-13-12-6-3-2-5-11(12)9-14(13)15/h2-8H,9H2,1H3,(H,16,17) |
| InChIKey | POECHIXSIXBYKI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-fluorenylacetamide (CHEBI:191149) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| N-(9H-luoren-1-yl)acetamide |
| Manual Xrefs | Databases |
|---|---|
| 31525 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:27215-65-2 | ChemIDplus |