EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO |
| Net Charge | 0 |
| Average Mass | 177.247 |
| Monoisotopic Mass | 177.11536 |
| SMILES | CC(=O)NC(C)Cc1ccccc1 |
| InChI | InChI=1S/C11H15NO/c1-9(12-10(2)13)8-11-6-4-3-5-7-11/h3-7,9H,8H2,1-2H3,(H,12,13) |
| InChIKey | YPKBVWZHVTZSPU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetylamphetamine (CHEBI:191146) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| N-(1-phenylpropan-2-yl)acetamide |
| Manual Xrefs | Databases |
|---|---|
| 24836 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:14383-60-9 | ChemIDplus |