EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7N3O6 |
| Net Charge | 0 |
| Average Mass | 241.159 |
| Monoisotopic Mass | 241.03348 |
| SMILES | O=C(O)CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7N3O6/c12-8(13)4-9-6-2-1-5(10(14)15)3-7(6)11(16)17/h1-3,9H,4H2,(H,12,13) |
| InChIKey | RQPREKYEHBAOAR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2,4-dinitrophenyl)glycine (CHEBI:191141) is a nitroaniline (CHEBI:25550) |
| IUPAC Name |
|---|
| 2-(2,4-dinitroanilino)acetic acid |