EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29N3O4 |
| Net Charge | 0 |
| Average Mass | 387.480 |
| Monoisotopic Mass | 387.21581 |
| SMILES | [H][C@]12CCCN1C(=O)[C@H](CCCCN)N([C@@H](CCc1ccccc1)C(=O)O)C2=O |
| InChI | InChI=1S/C21H29N3O4/c22-13-5-4-9-17-19(25)23-14-6-10-16(23)20(26)24(17)18(21(27)28)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18H,4-6,9-14,22H2,(H,27,28)/t16-,17+,18+/m1/s1 |
| InChIKey | FUEMHWCBWYXAOU-SQNIBIBYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lisinopril (8r,s)-diketopiperazine (CHEBI:191125) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[(3S,8aR)-3-(4-aminobutyl)-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl]-4-phenylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23936480 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:219677-82-4 | ChemIDplus |