EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O3 |
| Net Charge | 0 |
| Average Mass | 240.258 |
| Monoisotopic Mass | 240.07864 |
| SMILES | COC(=O)C1(O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H12O3/c1-18-14(16)15(17)12-8-4-2-6-10(12)11-7-3-5-9-13(11)15/h2-9,17H,1H3 |
| InChIKey | AJKQZRAAQMBNKM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Flurenol methyl ester (CHEBI:191115) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| methyl 9-hydroxyluorene-9-carboxylate |