EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N3O5 |
| Net Charge | 0 |
| Average Mass | 337.376 |
| Monoisotopic Mass | 337.16377 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](N)Cc1ccc(O)cc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C16H23N3O5/c1-9(2)14(16(24)18-8-13(21)22)19-15(23)12(17)7-10-3-5-11(20)6-4-10/h3-6,9,12,14,20H,7-8,17H2,1-2H3,(H,18,24)(H,19,23)(H,21,22)/t12-,14+/m1/s1 |
| InChIKey | NWEGIYMHTZXVBP-OCCSQVGLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dtyr-Val-Gly (CHEBI:191105) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[(2S)-2-[[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 5386356 | ChemSpider |