EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N4O3 |
| Net Charge | 0 |
| Average Mass | 176.176 |
| Monoisotopic Mass | 176.09094 |
| SMILES | N/C(=N\CC[C@H](N)C(=O)O)NO |
| InChI | InChI=1S/C5H12N4O3/c6-3(4(10)11)1-2-8-5(7)9-12/h3,12H,1-2,6H2,(H,10,11)(H3,7,8,9)/t3-/m0/s1 |
| InChIKey | KOBHCUDVWOTEKO-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nomega-hydroxy-nor-l-arginine (CHEBI:191070) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-[[amino-(hydroxyamino)methylidene]amino]butanoic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:189302-40-7 | ChemIDplus |