EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO2 |
| Net Charge | 0 |
| Average Mass | 181.235 |
| Monoisotopic Mass | 181.11028 |
| SMILES | [H][C@@]12CC=C(C(=O)OC)[C@@]([H])(CC1)N2C |
| InChI | InChI=1S/C10H15NO2/c1-11-7-3-5-8(10(12)13-2)9(11)6-4-7/h5,7,9H,3-4,6H2,1-2H3/t7-,9-/m1/s1 |
| InChIKey | MPSNEAHFGOEKBI-VXNVDRBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anhydroecgonine methyl ester (CHEBI:191065) is a N-alkylpyrrolidine (CHEBI:46775) |
| IUPAC Name |
|---|
| methyl (1R,5S)-8-methyl-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 106705 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:43021-26-7 | ChemIDplus |