EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO4 |
| Net Charge | 0 |
| Average Mass | 311.337 |
| Monoisotopic Mass | 311.11576 |
| SMILES | CO[C@H]1C=CC2=CC(=O)N3CCc4cc5c(cc4[C@]23C1)OCO5 |
| InChI | InChI=1S/C18H17NO4/c1-21-13-3-2-12-7-17(20)19-5-4-11-6-15-16(23-10-22-15)8-14(11)18(12,19)9-13/h2-3,6-8,13H,4-5,9-10H2,1H3/t13-,18-/m0/s1 |
| InChIKey | RNCIERMYMLFYAO-UGSOOPFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxoerythraline (CHEBI:191061) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (1S,19R)-19-methoxy-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,15,17-pentaen-14-one |
| Manual Xrefs | Databases |
|---|---|
| 10227700 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:58779-40-1 | ChemIDplus |