EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO3 |
| Net Charge | 0 |
| Average Mass | 173.212 |
| Monoisotopic Mass | 173.10519 |
| SMILES | CCCC[C@@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-3-4-5-7(8(11)12)9-6(2)10/h7H,3-5H2,1-2H3,(H,9,10)(H,11,12)/t7-/m1/s1 |
| InChIKey | JDMCEGLQFSOMQH-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-d-norleucine (CHEBI:191057) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2R)-2-acetamidohexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 5363073 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:54896-21-8 | ChemIDplus |