EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O3 |
| Net Charge | 0 |
| Average Mass | 358.522 |
| Monoisotopic Mass | 358.25079 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC1OC1CCC(=O)OC |
| InChI | InChI=1S/C23H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-22(26-21)19-20-23(24)25-2/h4-5,7-8,10-11,13-14,16-17,21-22H,3,6,9,12,15,18-20H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | WBYKJDXNMZXEMM-JEBPEJKESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-epoxy-7z,10z,13z,16z,19z-docosapentaenoic acid, methyl ester (CHEBI:191035) is a epoxy fatty acid (CHEBI:61498) |
| IUPAC Name |
|---|
| methyl 3-[3-[(2Z,5Z,8Z,11Z,14Z)-heptadeca-2,5,8,11,14-pentaenyl]oxiran-2-yl]propanoate |
| Manual Xrefs | Databases |
|---|---|
| 21467440 | ChemSpider |