EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO6 |
| Net Charge | 0 |
| Average Mass | 343.335 |
| Monoisotopic Mass | 343.10559 |
| SMILES | COc1ccc(/C=C\C(=O)Nc2c(O)cccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C18H17NO6/c1-24-14-8-6-11(10-15(14)25-2)7-9-16(21)19-17-12(18(22)23)4-3-5-13(17)20/h3-10,20H,1-2H3,(H,19,21)(H,22,23)/b9-7- |
| InChIKey | HUBVPPBIEOCMIE-CLFYSBASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benzoic acid, 2-[[(2z)-3-(3,4-dimethoxyphenyl)-1-oxo-2-propen-1-yl]amino]-3-hydroxy- (CHEBI:191019) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2-[[(Z)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-3-hydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 21467637 | ChemSpider |