EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N2O7 |
| Net Charge | 0 |
| Average Mass | 426.425 |
| Monoisotopic Mass | 426.14270 |
| SMILES | [H][C@@]12Cc3c(c(O)c4c(O)cccc4c3C)C(=O)[C@]1(O)C(O)=C(C(N)=O)C(=O)[C@H]2N(C)C |
| InChI | InChI=1S/C22H22N2O7/c1-8-9-5-4-6-12(25)13(9)17(26)14-10(8)7-11-16(24(2)3)18(27)15(21(23)30)20(29)22(11,31)19(14)28/h4-6,11,16,25-26,29,31H,7H2,1-3H3,(H2,23,30)/t11-,16-,22-/m0/s1 |
| InChIKey | KTTKGQINVKPHLY-DOCRCCHOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5a,6-anhydrotetracycline (CHEBI:191005) is a tetracyclines (CHEBI:26895) |
| IUPAC Name |
|---|
| (4S,4aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 61711312 | ChemSpider |
| C02811 | KEGG COMPOUND |
| LMPK02000007 | LIPID MAPS |