EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N |
| Net Charge | 0 |
| Average Mass | 149.237 |
| Monoisotopic Mass | 149.12045 |
| SMILES | CCCCc1ccccc1N |
| InChI | InChI=1S/C10H15N/c1-2-3-6-9-7-4-5-8-10(9)11/h4-5,7-8H,2-3,6,11H2,1H3 |
| InChIKey | HDVUPIFFKAHPJY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-butylaniline (CHEBI:190986) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-butylaniline |