EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:190974 - SU11274
| Formula | C28H30ClN5O4S |
| Net Charge | 0 |
| Average Mass | 568.099 |
| Monoisotopic Mass | 567.17070 |
| SMILES | Cc1nc(/C=C2\C(=O)Nc3ccc(S(=O)(=O)N(C)c4cccc(Cl)c4)cc32)c(C)c1C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C28H30ClN5O4S/c1-17-25(30-18(2)26(17)28(36)34-12-10-32(3)11-13-34)16-23-22-15-21(8-9-24(22)31-27(23)35)39(37,38)33(4)20-7-5-6-19(29)14-20/h5-9,14-16,30H,10-13H2,1-4H3,(H,31,35)/b23-16- |
| InChIKey | FPYJSJDOHRDAMT-KQWNVCNZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | c-Met tyrosine kinase inhibitor An EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor that interferes with the action of c-Met tyrosine kinase. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SU11274 (CHEBI:190974) has role antineoplastic agent (CHEBI:35610) |
| SU11274 (CHEBI:190974) has role apoptosis inducer (CHEBI:68495) |
| SU11274 (CHEBI:190974) has role autophagy inducer (CHEBI:138880) |
| SU11274 (CHEBI:190974) has role c-Met tyrosine kinase inhibitor (CHEBI:90199) |
| SU11274 (CHEBI:190974) is a N-acylpiperazine (CHEBI:46844) |
| SU11274 (CHEBI:190974) is a N-methylpiperazine (CHEBI:46920) |
| SU11274 (CHEBI:190974) is a aromatic ketone (CHEBI:76224) |
| SU11274 (CHEBI:190974) is a monochlorobenzenes (CHEBI:83403) |
| SU11274 (CHEBI:190974) is a olefinic compound (CHEBI:78840) |
| SU11274 (CHEBI:190974) is a oxindoles (CHEBI:38459) |
| SU11274 (CHEBI:190974) is a pyrrolecarboxamide (CHEBI:48611) |
| SU11274 (CHEBI:190974) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| (3Z)-N-(3-chlorophenyl)-3-({3,5-dimethyl-4-[(4-methylpiperazin-1-yl)carbonyl]-1H-pyrrol-2-yl}methylidene)-N-methyl-2-oxo-2,3-dihydro-1H-indole-5-sulfonamide |
| Synonyms | Source |
|---|---|
| SU 11274 | ChEBI |
| SU-11274 | ChEBI |
| PKI-SU11274 | ChEBI |
| Citations |
|---|