EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13N5 |
| Net Charge | 0 |
| Average Mass | 287.326 |
| Monoisotopic Mass | 287.11710 |
| SMILES | Cc1cccc(-c2nncc2-c2ccc3ncccc3n2)n1 |
| InChI | InChI=1S/C17H13N5/c1-11-4-2-5-16(20-11)17-12(10-19-22-17)13-7-8-14-15(21-13)6-3-9-18-14/h2-10H,1H3,(H,19,22) |
| InChIKey | LBPKYPYHDKKRFS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Biological Roles: | TGFbeta receptor antagonist An antagonist that binds to and deactivates TGFβ receptors. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RepSox (CHEBI:190969) has role antineoplastic agent (CHEBI:35610) |
| RepSox (CHEBI:190969) has role bone density conservation agent (CHEBI:50646) |
| RepSox (CHEBI:190969) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| RepSox (CHEBI:190969) has role TGFβ receptor antagonist (CHEBI:91202) |
| RepSox (CHEBI:190969) is a 1,5-naphthyridine derivative (CHEBI:73540) |
| RepSox (CHEBI:190969) is a pyrazoles (CHEBI:26410) |
| RepSox (CHEBI:190969) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 2-[3-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl]-1,5-naphthyridine |
| Synonyms | Source |
|---|---|
| 2-(3-(6-methylpyridine-2-yl)-1H-pyrazol-4-yl)-1,5-naphthyridine | ChEBI |
| ALK5 Inhibitor II | ChEBI |
| E 616452 | ChEBI |
| E-616452 | ChEBI |
| E616452 | ChEBI |
| SJN 2511 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 395681 | ChemSpider |
| HMDB0257156 | HMDB |
| RepSox | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9782770 | Reaxys |
| CAS:446859-33-2 | ChEBI |
| Citations |
|---|