EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:190963 - 2-aminobenzenecarbohydroxamic acid
| Formula | C7H8N2O2 |
| Net Charge | 0 |
| Average Mass | 152.153 |
| Monoisotopic Mass | 152.05858 |
| SMILES | Nc1ccccc1C(=O)NO |
| InChI | InChI=1S/C7H8N2O2/c8-6-4-2-1-3-5(6)7(10)9-11/h1-4,11H,8H2,(H,9,10) |
| InChIKey | VMKPDXOZTSISIW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminobenzenecarbohydroxamic acid (CHEBI:190963) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-amino-N-hydroxybenzamide |