EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO |
| Net Charge | 0 |
| Average Mass | 137.182 |
| Monoisotopic Mass | 137.08406 |
| SMILES | CCOc1ccccc1N |
| InChI | InChI=1S/C8H11NO/c1-2-10-8-6-4-3-5-7(8)9/h3-6H,2,9H2,1H3 |
| InChIKey | ULHFFAFDSSHFDA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-amino-2-ethoxybenzene (CHEBI:190954) is a aromatic ether (CHEBI:35618) |
| 1-amino-2-ethoxybenzene (CHEBI:190954) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-ethoxyaniline |