EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:190935 - (+/-)-n-ethyl-1-phenyl-2-butylamine
| Formula | C12H19N |
| Net Charge | 0 |
| Average Mass | 177.291 |
| Monoisotopic Mass | 177.15175 |
| SMILES | CCNC(CC)Cc1ccccc1 |
| InChI | InChI=1S/C12H19N/c1-3-12(13-4-2)10-11-8-6-5-7-9-11/h5-9,12-13H,3-4,10H2,1-2H3 |
| InChIKey | KHWYSUBVXWWBRB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+/-)-n-ethyl-1-phenyl-2-butylamine (CHEBI:190935) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| N-ethyl-1-phenylbutan-2-amine |
| Manual Xrefs | Databases |
|---|---|
| 27101303 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:119486-07-6 | ChemIDplus |