EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N2O2 |
| Net Charge | 0 |
| Average Mass | 240.262 |
| Monoisotopic Mass | 240.08988 |
| SMILES | O=C(O)CCc1nccc2c1nc1ccccc12 |
| InChI | InChI=1S/C14H12N2O2/c17-13(18)6-5-12-14-10(7-8-15-12)9-3-1-2-4-11(9)16-14/h1-4,7-8,16H,5-6H2,(H,17,18) |
| InChIKey | CNUHEVWYPKFJHH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | INS-1 cell (BTO:0002135) | MetaboLights (MTBLS3963) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beta-carboline-1-propionic acid (CHEBI:190929) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 3-(9H-pyrido[3,4-b]indol-1-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4524921 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:89915-39-9 | ChemIDplus |