EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O10 |
| Net Charge | 0 |
| Average Mass | 332.261 |
| Monoisotopic Mass | 332.07435 |
| SMILES | O=C(OC1OC(CO)C(O)C(O)C1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C13H16O10/c14-3-7-9(18)10(19)11(20)13(22-7)23-12(21)4-1-5(15)8(17)6(16)2-4/h1-2,7,9-11,13-20H,3H2 |
| InChIKey | GDVRUDXLQBVIKP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | root (BTO:0001188) | MetaboLights (MTBLS4362) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3,4,5-trihydroxybenzoate (CHEBI:190910) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3,4,5-trihydroxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 3818711 | ChemSpider |
| HMDB0038728 | HMDB |