EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O10P |
| Net Charge | 0 |
| Average Mass | 274.118 |
| Monoisotopic Mass | 274.00898 |
| SMILES | O=C(O)[C@H]1O[C@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2122A-1a_1-5_1*OPO/3O/3=O]/1/ |
| InChI | InChI=1S/C6H11O10P/c7-1-2(8)4(5(10)11)15-6(3(1)9)16-17(12,13)14/h1-4,6-9H,(H,10,11)(H2,12,13,14)/t1-,2-,3+,4-,6+/m0/s1 |
| InChIKey | AIQDYKMWENWVQJ-QIUUJYRFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-phospho-α-D-glucuronic acid (CHEBI:16787) has functional parent α-D-glucuronic acid (CHEBI:42717) |
| 1-phospho-α-D-glucuronic acid (CHEBI:16787) is a D-glucuronic acid 1-phosphate (CHEBI:35145) |
| 1-phospho-α-D-glucuronic acid (CHEBI:16787) is a glucuronic acids (CHEBI:33886) |
| 1-phospho-α-D-glucuronic acid (CHEBI:16787) is conjugate acid of 1-phosphonato-α-D-glucuronate(3−) (CHEBI:57897) |
| Incoming Relation(s) |
| 1-phosphonato-α-D-glucuronate(3−) (CHEBI:57897) is conjugate base of 1-phospho-α-D-glucuronic acid (CHEBI:16787) |
| IUPAC Name |
|---|
| 1-O-phosphono-α-D-glucopyranuronic acid |
| Synonyms | Source |
|---|---|
| 1-Phospho-alpha-D-glucuronate | KEGG COMPOUND |
| 1-Phospho-alpha-D-glucuronate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05385 | KEGG COMPOUND |