EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27N3O9S |
| Net Charge | 0 |
| Average Mass | 473.504 |
| Monoisotopic Mass | 473.14680 |
| SMILES | NC(CCC(=O)NC(CSC(CO)C(O)c1ccccc1O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H27N3O9S/c20-11(19(30)31)5-6-15(25)22-12(18(29)21-7-16(26)27)9-32-14(8-23)17(28)10-3-1-2-4-13(10)24/h1-4,11-12,14,17,23-24,28H,5-9,20H2,(H,21,29)(H,22,25)(H,26,27)(H,30,31) |
| InChIKey | LPLOTUHHDCJLRU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | root (BTO:0001188) | MetaboLights (MTBLS4362) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-({1-[(carboxymethyl)-C-hydroxycarbonimidoyl]-2-{[1,3-dihydroxy-1-(2-hydroxyphenyl)propan-2-yl]sulfanyl}ethyl}-C-hydroxycarbonimidoyl)butanoic acid (CHEBI:190892) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-amino-5-[[1-(carboxymethylamino)-3-[1,3-dihydroxy-1-(2-hydroxyphenyl)propan-2-yl]sulanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0134078 | HMDB |